Products 2733795-10-1
CAS 2733795-10-1 is the registry number for (4-Amino-3-(tert-butyl)phenyl)methanol, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4-amino-3-tert-butylphenyl)methanol (CAS 2733795-10-1) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. IUPAC name: (4-amino-3-tert-butylphenyl)methanol. InChIKey: MVQOZFCBIAKIBF-UHFFFAOYSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 179.26 g/mol |
| IUPAC name | (4-amino-3-tert-butylphenyl)methanol |
| InChIKey | MVQOZFCBIAKIBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)CO)N |
Computed by PubChem (NCBI)