Products 2733833-08-2
CAS 2733833-08-2 is the registry number for N1, N10-Diacetyl triethylenetetramine-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
N-[2-[[2-(2-acetamidoethylamino)-1,1,2,2-tetradeuterioethyl]amino]ethyl]acetamide (CAS 2733833-08-2) is a chemical compound with the molecular formula C10H22N4O2 and a molecular weight of 234.33 g/mol. IUPAC name: N-[2-[[2-(2-acetamidoethylamino)-1,1,2,2-tetradeuterioethyl]amino]ethyl]acetamide. InChIKey: WJZSOPBEHMQITR-KHORGVISSA-N.
| Molecular formula | C10H22N4O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | N-[2-[[2-(2-acetamidoethylamino)-1,1,2,2-tetradeuterioethyl]amino]ethyl]acetamide |
| InChIKey | WJZSOPBEHMQITR-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])NCCNC(=O)C)NCCNC(=O)C |
Computed by PubChem (NCBI)