Products 925-83-7

CAS 925-83-7 appears in our catalog under these names: Sebacic Dihydrazide, Sebacic Dihydrazide, >96.0%(T)(HPLC), Decanedioic acid 1,10-dihydrazide, 96%, 96%, Sebacic acid dihydrazide, 96%, Decanedihydrazide, 96%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 500g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Decanedihydrazide (CAS 925-83-7) is a chemical compound with the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. IUPAC name: decanedihydrazide. InChIKey: ZWLIYXJBOIDXLL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H22N4O2
Molecular weight230.31 g/mol
IUPAC namedecanedihydrazide
InChIKeyZWLIYXJBOIDXLL-UHFFFAOYSA-N
SMILESC(CCCCC(=O)NN)CCCC(=O)NN

Computed by PubChem (NCBI)