Products 2733972-12-6
CAS 2733972-12-6 appears in our catalog under these names: Bisphenol Z–d6, Bisphenol Z-d6. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg.
4-[3,3,4,4,5,5-hexadeuterio-1-(4-hydroxyphenyl)cyclohexyl]phenol (CAS 2733972-12-6) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 274.4 g/mol. IUPAC name: 4-[3,3,4,4,5,5-hexadeuterio-1-(4-hydroxyphenyl)cyclohexyl]phenol. InChIKey: SDDLEVPIDBLVHC-NMFSSPJFSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-[3,3,4,4,5,5-hexadeuterio-1-(4-hydroxyphenyl)cyclohexyl]phenol |
| InChIKey | SDDLEVPIDBLVHC-NMFSSPJFSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])[2H])([2H])[2H])(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Bisphenol Z-d6