Products 2734096-32-1
CAS 2734096-32-1 is the registry number for N,N-Dimethyl-2-((RS)-1-phenyl(pyridin-2-yl)methoxy)ethanamine Hydrogen Fumarate. Offered by: Mikromol. Available pack sizes: 50mg.
(E)-but-2-enedioic acid;N,N-dimethyl-2-[phenyl(pyridin-2-yl)methoxy]ethanamine (CAS 2734096-32-1) is a chemical compound with the molecular formula C20H24N2O5 and a molecular weight of 372.4 g/mol. IUPAC name: (E)-but-2-enedioic acid;N,N-dimethyl-2-[phenyl(pyridin-2-yl)methoxy]ethanamine. InChIKey: GUMYXMIQQGAXKP-WLHGVMLRSA-N.
| Molecular formula | C20H24N2O5 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;N,N-dimethyl-2-[phenyl(pyridin-2-yl)methoxy]ethanamine |
| InChIKey | GUMYXMIQQGAXKP-WLHGVMLRSA-N |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=N2.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)