Products 2734773-36-3
CAS 2734773-36-3 is the registry number for 2-(4-Chloro-2,3-difluorophenyl)propan-2-ol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-(4-chloro-2,3-difluorophenyl)propan-2-ol (CAS 2734773-36-3) is a chemical compound with the molecular formula C9H9ClF2O and a molecular weight of 206.61 g/mol. IUPAC name: 2-(4-chloro-2,3-difluorophenyl)propan-2-ol. InChIKey: UUEGGOZGMOEHQP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF2O |
|---|---|
| Molecular weight | 206.61 g/mol |
| IUPAC name | 2-(4-chloro-2,3-difluorophenyl)propan-2-ol |
| InChIKey | UUEGGOZGMOEHQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=C(C=C1)Cl)F)F)O |
Computed by PubChem (NCBI)