Products 2734775-48-3
CAS 2734775-48-3 is the registry number for (6-Chloro-2-fluoro-3-methoxyphenyl)-1-piperidinylmethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(6-chloro-2-fluoro-3-methoxyphenyl)-piperidin-1-ylmethanone (CAS 2734775-48-3) is a chemical compound with the molecular formula C13H15ClFNO2 and a molecular weight of 271.71 g/mol. IUPAC name: (6-chloro-2-fluoro-3-methoxyphenyl)-piperidin-1-ylmethanone. InChIKey: WMFPTWXVQUAMNI-UHFFFAOYSA-N.
| Molecular formula | C13H15ClFNO2 |
|---|---|
| Molecular weight | 271.71 g/mol |
| IUPAC name | (6-chloro-2-fluoro-3-methoxyphenyl)-piperidin-1-ylmethanone |
| InChIKey | WMFPTWXVQUAMNI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)C(=O)N2CCCCC2)F |
Computed by PubChem (NCBI)