CAS 936648-40-7 appears in our catalog under these names: 6-Fluorospiro[chroman-2,4'-piperidin]-4-one hydrochloride, 97%, 6-Fluorospiro(chroman-2,4'-piperidin)-4-one HCl, 97%, 6–FLUOROSPIRO(CHROMAN–2,4'–PIPERIDIN)–4–ONE HCL, 6-Fluorospiro(chroman-2,4'-piperidin)-4-one HCl. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (CAS 936648-40-7) is a chemical compound with the molecular formula C13H15ClFNO2 and a molecular weight of 271.71 g/mol. IUPAC name: 6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride. InChIKey: VITABEUPCHVIAC-UHFFFAOYSA-N.
| Molecular formula | C13H15ClFNO2 |
|---|---|
| Molecular weight | 271.71 g/mol |
| IUPAC name | 6-fluorospiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| InChIKey | VITABEUPCHVIAC-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(=O)C3=C(O2)C=CC(=C3)F.Cl |
Computed by PubChem (NCBI)