Products 2734776-78-2
CAS 2734776-78-2 is the registry number for 2,2-Dichloro-1-(3,5-dimethylphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(3,5-dimethylphenyl)ethanol (CAS 2734776-78-2) is a chemical compound with the molecular formula C10H12Cl2O and a molecular weight of 219.10 g/mol. IUPAC name: 2,2-dichloro-1-(3,5-dimethylphenyl)ethanol. InChIKey: YRJYMOLNEIACDF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O |
|---|---|
| Molecular weight | 219.10 g/mol |
| IUPAC name | 2,2-dichloro-1-(3,5-dimethylphenyl)ethanol |
| InChIKey | YRJYMOLNEIACDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C(Cl)Cl)O)C |
Computed by PubChem (NCBI)