Products 2734868-26-7
CAS 2734868-26-7 is the registry number for (1R,4S,7S)-5-Benzyl-2-oxa-5-azabicyclo[2.2.1]heptan-7-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,4S,7S)-5-benzyl-2-oxa-5-azabicyclo[2.2.1]heptan-7-amine (CAS 2734868-26-7) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: (1R,4S,7S)-5-benzyl-2-oxa-5-azabicyclo[2.2.1]heptan-7-amine. InChIKey: DBRZMZODGYJIDT-UTUOFQBUSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | (1R,4S,7S)-5-benzyl-2-oxa-5-azabicyclo[2.2.1]heptan-7-amine |
| InChIKey | DBRZMZODGYJIDT-UTUOFQBUSA-N |
| SMILES | C1[C@@H]2[C@H]([C@H](N1CC3=CC=CC=C3)CO2)N |
Computed by PubChem (NCBI)