Products 2735803-20-8
CAS 2735803-20-8 appears in our catalog under these names: DS20362725, DS20362725, 99.34%, DS20362725, 98%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 5mg, 50mg, 10mM/1mL, 25 mg, 50 mg, 5 mg, 100 mg.
2-tert-butyl-4-(2,3-dimethylbenzimidazol-5-yl)oxyphenol (CAS 2735803-20-8) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: 2-tert-butyl-4-(2,3-dimethylbenzimidazol-5-yl)oxyphenol. InChIKey: LQWRSCHPPDJXLC-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-tert-butyl-4-(2,3-dimethylbenzimidazol-5-yl)oxyphenol |
| InChIKey | LQWRSCHPPDJXLC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C=C(C=C2)OC3=CC(=C(C=C3)O)C(C)(C)C |
Computed by PubChem (NCBI)