Products 2738500-09-7
CAS 2738500-09-7 is the registry number for tert-butyl 3-(1-ethoxy-1-oxopropan-2-ylidene)piperidine-1-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3E)-3-(1-ethoxy-1-oxopropan-2-ylidene)piperidine-1-carboxylate (CAS 2738500-09-7) is a chemical compound with the molecular formula C15H25NO4 and a molecular weight of 283.36 g/mol. IUPAC name: tert-butyl (3E)-3-(1-ethoxy-1-oxopropan-2-ylidene)piperidine-1-carboxylate. InChIKey: DVZYOKNOYJPPCG-VAWYXSNFSA-N.
| Molecular formula | C15H25NO4 |
|---|---|
| Molecular weight | 283.36 g/mol |
| IUPAC name | tert-butyl (3E)-3-(1-ethoxy-1-oxopropan-2-ylidene)piperidine-1-carboxylate |
| InChIKey | DVZYOKNOYJPPCG-VAWYXSNFSA-N |
| SMILES | CCOC(=O)/C(=C/1\CCCN(C1)C(=O)OC(C)(C)C)/C |
Computed by PubChem (NCBI)