CAS 273937-87-4 is the registry number for 2′-Methyl-(1,1′-biphenyl)-4-yl trifluoromethanesulfonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
[4-(2-methylphenyl)phenyl] trifluoromethanesulfonate (CAS 273937-87-4) is a chemical compound with the molecular formula C14H11F3O3S and a molecular weight of 316.30 g/mol. IUPAC name: [4-(2-methylphenyl)phenyl] trifluoromethanesulfonate. InChIKey: DGDXJCZNOJKVMD-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O3S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | [4-(2-methylphenyl)phenyl] trifluoromethanesulfonate |
| InChIKey | DGDXJCZNOJKVMD-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)