CAS 343375-98-4 appears in our catalog under these names: Methyl 3-((3-(trifluoromethyl)benzyl)oxy)thiophene-2-carboxylate, 97%, Methyl 3-{[3-(trifluoromethyl)benzyl]oxy}-2-thiophenecarboxylate. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 500mg, 1g.
Methyl 3-[[3-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxylate (CAS 343375-98-4) is a chemical compound with the molecular formula C14H11F3O3S and a molecular weight of 316.30 g/mol. IUPAC name: methyl 3-[[3-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxylate. InChIKey: AWWGGWWMTZUJDX-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O3S |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | methyl 3-[[3-(trifluoromethyl)phenyl]methoxy]thiophene-2-carboxylate |
| InChIKey | AWWGGWWMTZUJDX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)OCC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)