CAS 27402-68-2 appears in our catalog under these names: 6-Nitrofluorescein, 98%, 6–Nitrofluorescein (isomer II), 6-Nitrofluorescein (isomer II), >98.0%(T)(HPLC), 3',6'-Dihydroxy-6-nitro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one 97%, 3',6'-Dihydroxy-6-nitro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 200mg, 100mg.
3',6'-dihydroxy-5-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 27402-68-2) is a chemical compound with the molecular formula C20H11NO7 and a molecular weight of 377.3 g/mol. IUPAC name: 3',6'-dihydroxy-5-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: GYWGQAIDMYGOLU-UHFFFAOYSA-N.
| Molecular formula | C20H11NO7 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | 3',6'-dihydroxy-5-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | GYWGQAIDMYGOLU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Computed by PubChem (NCBI)