CAS 3326-35-0 appears in our catalog under these names: 5-Nitrofluorescein, 97%, 3',6'-Dihydroxy-5-nitro-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one, 97%, Nitrofluorescein, Isomer 1, 5-Nitrofluorescein (isomer I), >98.0%(T). Offered by: Combi-blocks, Chemat Brand, TRC, TCI. Available pack sizes: 5g, 1g, on request.
3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 3326-35-0) is a chemical compound with the molecular formula C20H11NO7 and a molecular weight of 377.3 g/mol. IUPAC name: 3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: UACQOMKZFGNRBL-UHFFFAOYSA-N.
| Molecular formula | C20H11NO7 |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | 3',6'-dihydroxy-6-nitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | UACQOMKZFGNRBL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)