CAS 27423-80-9 appears in our catalog under these names: 2-(3-(Trifluoromethyl)phenyl)-1H-imidazole, 95+%, 2-(3-(Trifluoromethyl)phenyl)-1H-imidazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
2-[3-(trifluoromethyl)phenyl]-1H-imidazole (CAS 27423-80-9) is a chemical compound with the molecular formula C10H7F3N2 and a molecular weight of 212.17 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]-1H-imidazole. InChIKey: FKNKITNWTIFPFX-UHFFFAOYSA-N.
| Molecular formula | C10H7F3N2 |
|---|---|
| Molecular weight | 212.17 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]-1H-imidazole |
| InChIKey | FKNKITNWTIFPFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NC=CN2 |
Computed by PubChem (NCBI)