Products 2742623-46-5
CAS 2742623-46-5 appears in our catalog under these names: (R)-1-(Methylsulfonyl)piperidin-3-amine hydrochloride, 95%, 95%, (R)-1-(Methylsulfonyl)piperidin-3-amine (hydrochloride), 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg.
(3R)-1-methylsulfonylpiperidin-3-amine;hydrochloride (CAS 2742623-46-5) is a chemical compound with the molecular formula C6H15ClN2O2S and a molecular weight of 214.71 g/mol. IUPAC name: (3R)-1-methylsulfonylpiperidin-3-amine;hydrochloride. InChIKey: MJAGCBBGJUYWPB-FYZOBXCZSA-N.
| Molecular formula | C6H15ClN2O2S |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | (3R)-1-methylsulfonylpiperidin-3-amine;hydrochloride |
| InChIKey | MJAGCBBGJUYWPB-FYZOBXCZSA-N |
| SMILES | CS(=O)(=O)N1CCC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)