Products 2742706-72-3
CAS 2742706-72-3 is the registry number for Nirmatrelvir Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile (CAS 2742706-72-3) is a chemical compound with the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. IUPAC name: (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile. InChIKey: XCZYYPNBFOATIK-WDSKDSINSA-N.
| Molecular formula | C7H11N3O |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile |
| InChIKey | XCZYYPNBFOATIK-WDSKDSINSA-N |
| SMILES | C1CNC(=O)[C@@H]1C[C@@H](C#N)N |
Computed by PubChem (NCBI)