CAS 27428-57-5 appears in our catalog under these names: 4–Bromo–4'–chlorobenzophenone, 4-Bromo-4'-chlorobenzophenone, >98.0%(GC), (4-Bromophenyl)(4-chlorophenyl)methanone 98%, (4-Bromophenyl)(4-chlorophenyl)methanone, 98%, 98%, 4-Bromo-4'-chlorobenzophenone, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
(4-bromophenyl)-(4-chlorophenyl)methanone (CAS 27428-57-5) is a chemical compound with the molecular formula C13H8BrClO and a molecular weight of 295.56 g/mol. IUPAC name: (4-bromophenyl)-(4-chlorophenyl)methanone. InChIKey: FYMCXGILCMIOKD-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClO |
|---|---|
| Molecular weight | 295.56 g/mol |
| IUPAC name | (4-bromophenyl)-(4-chlorophenyl)methanone |
| InChIKey | FYMCXGILCMIOKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)