Products 75762-56-0
CAS 75762-56-0 appears in our catalog under these names: (3-bromophenyl)(4-chlorophenyl)methanone, 95%, 95%, 3-Bromo-4'-chlorobenzophenone, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3-bromophenyl)-(4-chlorophenyl)methanone (CAS 75762-56-0) is a chemical compound with the molecular formula C13H8BrClO and a molecular weight of 295.56 g/mol. IUPAC name: (3-bromophenyl)-(4-chlorophenyl)methanone. InChIKey: JDSRHMLEPCMXHS-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClO |
|---|---|
| Molecular weight | 295.56 g/mol |
| IUPAC name | (3-bromophenyl)-(4-chlorophenyl)methanone |
| InChIKey | JDSRHMLEPCMXHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)