CAS 27430-50-8 appears in our catalog under these names: 3-(4,4-Dimethyl-2,5-dioxoimidazolidin-1-yl)propanenitrile, 95%, 3-(4,4-Dimethyl-2,5-dioxoimidazolidin-1-yl)propanenitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanenitrile (CAS 27430-50-8) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanenitrile. InChIKey: YVFPANAAHOFIGJ-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanenitrile |
| InChIKey | YVFPANAAHOFIGJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1)CCC#N)C |
Computed by PubChem (NCBI)