CAS 274691-33-7 is the registry number for 2,4-Dichloro-8-methoxy-3-phenylquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2,4-dichloro-8-methoxy-3-phenylquinoline (CAS 274691-33-7) is a chemical compound with the molecular formula C16H11Cl2NO and a molecular weight of 304.2 g/mol. IUPAC name: 2,4-dichloro-8-methoxy-3-phenylquinoline. InChIKey: HCBGBBAKJVKMPV-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2NO |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2,4-dichloro-8-methoxy-3-phenylquinoline |
| InChIKey | HCBGBBAKJVKMPV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1N=C(C(=C2Cl)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)