CAS 87894-43-7 is the registry number for (2,6-Dichlorophenyl)-(3-methylindol-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.
(2,6-dichlorophenyl)-(3-methylindol-1-yl)methanone (CAS 87894-43-7) is a chemical compound with the molecular formula C16H11Cl2NO and a molecular weight of 304.2 g/mol. IUPAC name: (2,6-dichlorophenyl)-(3-methylindol-1-yl)methanone. InChIKey: SNKPYMNPXYWFRX-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2NO |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | (2,6-dichlorophenyl)-(3-methylindol-1-yl)methanone |
| InChIKey | SNKPYMNPXYWFRX-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=CC=CC=C12)C(=O)C3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)