CAS 27477-88-9 is the registry number for 1,4,5,8,9-Pentamethylcarbazole. Offered by: Biosynth. Available pack sizes: 250mg, 500mg, 1000mg, 5000mg.
1,4,5,8,9-pentamethylcarbazole (CAS 27477-88-9) is a chemical compound with the molecular formula C17H19N and a molecular weight of 237.34 g/mol. IUPAC name: 1,4,5,8,9-pentamethylcarbazole. InChIKey: LKVSJOBCOXSNCF-UHFFFAOYSA-N.
| Molecular formula | C17H19N |
|---|---|
| Molecular weight | 237.34 g/mol |
| IUPAC name | 1,4,5,8,9-pentamethylcarbazole |
| InChIKey | LKVSJOBCOXSNCF-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(C=CC(=C3N(C2=C(C=C1)C)C)C)C |
Computed by PubChem (NCBI)