Products 2747917-84-4
CAS 2747917-84-4 appears in our catalog under these names: JWH-019 (Indole-d5) 5-Hydroxyhexyl, JWH 019 N–(5–hydroxyhexyl) metabolite–d5. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 1mg, 100μg, 500μg.
Naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-hydroxyhexyl)indol-3-yl]methanone (CAS 2747917-84-4) is a chemical compound with the molecular formula C25H25NO2 and a molecular weight of 376.5 g/mol. IUPAC name: naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-hydroxyhexyl)indol-3-yl]methanone. InChIKey: OMWLYFDUQMJPOS-IHUSPWCGSA-N.
| Molecular formula | C25H25NO2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-hydroxyhexyl)indol-3-yl]methanone |
| InChIKey | OMWLYFDUQMJPOS-IHUSPWCGSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(C)O)[2H])C(=O)C3=CC=CC4=CC=CC=C43)[2H])[2H] |
Computed by PubChem (NCBI)