CAS 2749387-95-7 appears in our catalog under these names: JWH-122 (Indole-d5) 5-Hydroxypentyl, JWH 122 N–(5–hydroxypentyl) metabolite–d5. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 1mg, 100μg, 500μg.
(4-methylnaphthalen-1-yl)-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone (CAS 2749387-95-7) is a chemical compound with the molecular formula C25H25NO2 and a molecular weight of 376.5 g/mol. IUPAC name: (4-methylnaphthalen-1-yl)-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone. InChIKey: JRALTDRFXRCGRH-UCXXKCETSA-N.
| Molecular formula | C25H25NO2 |
|---|---|
| Molecular weight | 376.5 g/mol |
| IUPAC name | (4-methylnaphthalen-1-yl)-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone |
| InChIKey | JRALTDRFXRCGRH-UCXXKCETSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCO)[2H])C(=O)C3=CC=C(C4=CC=CC=C43)C)[2H])[2H] |
Computed by PubChem (NCBI)