Products 2748212-89-5
CAS 2748212-89-5 appears in our catalog under these names: JWH-250 (Indole-d5) 5-Hydroxypentyl, JWH 250 N–(5–hydroxypentyl) metabolite–d5. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 1mg, 100μg, 500μg.
2-(2-methoxyphenyl)-1-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]ethanone (CAS 2748212-89-5) is a chemical compound with the molecular formula C22H25NO3 and a molecular weight of 356.5 g/mol. IUPAC name: 2-(2-methoxyphenyl)-1-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]ethanone. InChIKey: BEAGHVHOGRTTHK-CGSQFYLRSA-N.
| Molecular formula | C22H25NO3 |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-1-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]ethanone |
| InChIKey | BEAGHVHOGRTTHK-CGSQFYLRSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCO)[2H])C(=O)CC3=CC=CC=C3OC)[2H])[2H] |
Computed by PubChem (NCBI)