Products 2748259-13-2
CAS 2748259-13-2 is the registry number for trans-2-(Trifluoromethyl)piperidin-4-ol Hydrochloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,4S)-2-(trifluoromethyl)piperidin-4-ol;hydrochloride (CAS 2748259-13-2) is a chemical compound with the molecular formula C6H11ClF3NO and a molecular weight of 205.60 g/mol. IUPAC name: (2S,4S)-2-(trifluoromethyl)piperidin-4-ol;hydrochloride. InChIKey: XDGKYPHUYSMOSE-FHAQVOQBSA-N.
| Molecular formula | C6H11ClF3NO |
|---|---|
| Molecular weight | 205.60 g/mol |
| IUPAC name | (2S,4S)-2-(trifluoromethyl)piperidin-4-ol;hydrochloride |
| InChIKey | XDGKYPHUYSMOSE-FHAQVOQBSA-N |
| SMILES | C1CN[C@@H](C[C@H]1O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)