CAS 2748319-68-6 is the registry number for 2,4,5-Tribromo-3,6-difluorobenzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4,5-tribromo-3,6-difluorobenzonitrile (CAS 2748319-68-6) is a chemical compound with the molecular formula C7Br3F2N and a molecular weight of 375.79 g/mol. IUPAC name: 2,4,5-tribromo-3,6-difluorobenzonitrile. InChIKey: XTNWYPCKYWEBGI-UHFFFAOYSA-N.
| Molecular formula | C7Br3F2N |
|---|---|
| Molecular weight | 375.79 g/mol |
| IUPAC name | 2,4,5-tribromo-3,6-difluorobenzonitrile |
| InChIKey | XTNWYPCKYWEBGI-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1Br)F)Br)Br)F |
Computed by PubChem (NCBI)