CAS 943528-40-3 appears in our catalog under these names: 2,4,6-Tribromo-3,5-difluorobenzonitrile, 95%, 2,4,6-Tribromo-3,5-difluorobenzonitrile, 98%, 2,4,6–tribromo–3,5–difluorobenzonitrile, 2,4,6-tribromo-3,5-difluorobenzonitrile, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg.
2,4,6-tribromo-3,5-difluorobenzonitrile (CAS 943528-40-3) is a chemical compound with the molecular formula C7Br3F2N and a molecular weight of 375.79 g/mol. IUPAC name: 2,4,6-tribromo-3,5-difluorobenzonitrile. InChIKey: AQPZRWDNSAKHNA-UHFFFAOYSA-N.
| Molecular formula | C7Br3F2N |
|---|---|
| Molecular weight | 375.79 g/mol |
| IUPAC name | 2,4,6-tribromo-3,5-difluorobenzonitrile |
| InChIKey | AQPZRWDNSAKHNA-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1Br)F)Br)F)Br |
Computed by PubChem (NCBI)