Products 2748335-77-3
CAS 2748335-77-3 is the registry number for JWH 203 N–(5–hydroxypentyl) metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
2-(2-chlorophenyl)-1-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]ethanone (CAS 2748335-77-3) is a chemical compound with the molecular formula C21H22ClNO2 and a molecular weight of 360.9 g/mol. IUPAC name: 2-(2-chlorophenyl)-1-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]ethanone. InChIKey: RFHPYWJZEUWQOM-JFISFECYSA-N.
| Molecular formula | C21H22ClNO2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]ethanone |
| InChIKey | RFHPYWJZEUWQOM-JFISFECYSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCO)[2H])C(=O)CC3=CC=CC=C3Cl)[2H])[2H] |
Computed by PubChem (NCBI)