CAS 2748464-24-4 is the registry number for AM2201–d5 (exempt preparation). Offered by: GLPBio. Available pack sizes: 1mg.
Naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-fluoropentyl)indol-3-yl]methanone (CAS 2748464-24-4) is a chemical compound with the molecular formula C24H22FNO and a molecular weight of 364.5 g/mol. IUPAC name: naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-fluoropentyl)indol-3-yl]methanone. InChIKey: ALQFAGFPQCBPED-QWWVLHFXSA-N.
| Molecular formula | C24H22FNO |
|---|---|
| Molecular weight | 364.5 g/mol |
| IUPAC name | naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-fluoropentyl)indol-3-yl]methanone |
| InChIKey | ALQFAGFPQCBPED-QWWVLHFXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCF)[2H])C(=O)C3=CC=CC4=CC=CC=C43)[2H])[2H] |
Computed by PubChem (NCBI)