Products 2748469-26-1
CAS 2748469-26-1 appears in our catalog under these names: JWH 018 N–(5–hydroxypentyl) metabolite–d5, JWH-018 (indole-d5) ω-Hydroxypentyl. Offered by: GLPBio, TRC. Available pack sizes: 1mg, 25mg, 100μg, 500μg.
Naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone (CAS 2748469-26-1) is a chemical compound with the molecular formula C24H23NO2 and a molecular weight of 362.5 g/mol. IUPAC name: naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone. InChIKey: UGHBAICDASCCIQ-QWWVLHFXSA-N.
| Molecular formula | C24H23NO2 |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone |
| InChIKey | UGHBAICDASCCIQ-QWWVLHFXSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCO)[2H])C(=O)C3=CC=CC4=CC=CC=C43)[2H])[2H] |
Computed by PubChem (NCBI)