CAS 335161-21-2 appears in our catalog under these names: JWH-018 ω-Hydroxypentyl, JWH-018 N-(5-hydroxypentyl) metabolite, JWH-018 N-(5-hydroxypentyl) metabolite, 0.1mg/ml in Methanol, JWH-018 N-(5-hydroxypentyl) metabolite, 1mg/ml in Methanol, JWH 018 N–(5–hydroxypentyl) metabolite. Offered by: TRC, Lipomed, GLPBio, Biosynth. Available pack sizes: 250mg, 50mg, 100mg, 10mg, 1ml, 1mg, 5mg, 25mg.
[1-(5-hydroxypentyl)indol-3-yl]-naphthalen-1-ylmethanone (CAS 335161-21-2) is a chemical compound with the molecular formula C24H23NO2 and a molecular weight of 357.4 g/mol. IUPAC name: [1-(5-hydroxypentyl)indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: UGHBAICDASCCIQ-UHFFFAOYSA-N.
| Molecular formula | C24H23NO2 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | [1-(5-hydroxypentyl)indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | UGHBAICDASCCIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)C3=CN(C4=CC=CC=C43)CCCCCO |
Computed by PubChem (NCBI)