Products 2748790-08-9
CAS 2748790-08-9 is the registry number for 4-Bromo-5-fluoro-2,2-dimethyl-2,3-dihydrobenzofuran-7-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-carboxylic acid (CAS 2748790-08-9) is a chemical compound with the molecular formula C11H10BrFO3 and a molecular weight of 289.10 g/mol. IUPAC name: 4-bromo-5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-carboxylic acid. InChIKey: PVIUSGJBXIZMIM-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO3 |
|---|---|
| Molecular weight | 289.10 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2,2-dimethyl-3H-1-benzofuran-7-carboxylic acid |
| InChIKey | PVIUSGJBXIZMIM-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC(=C2Br)F)C(=O)O)C |
Computed by PubChem (NCBI)