Products 2918889-25-3
CAS 2918889-25-3 is the registry number for ethyl 2-(2-bromo-6-fluoro-4-methylphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(2-bromo-6-fluoro-4-methylphenyl)-2-oxoacetate (CAS 2918889-25-3) is a chemical compound with the molecular formula C11H10BrFO3 and a molecular weight of 289.10 g/mol. IUPAC name: ethyl 2-(2-bromo-6-fluoro-4-methylphenyl)-2-oxoacetate. InChIKey: ZSIRVVVOEKCIIY-UHFFFAOYSA-N.
| Molecular formula | C11H10BrFO3 |
|---|---|
| Molecular weight | 289.10 g/mol |
| IUPAC name | ethyl 2-(2-bromo-6-fluoro-4-methylphenyl)-2-oxoacetate |
| InChIKey | ZSIRVVVOEKCIIY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=C(C=C1Br)C)F |
Computed by PubChem (NCBI)