CAS 274927-61-6 appears in our catalog under these names: (S)-Methyl 2-amino-3-(1-benzyl-1h-imidazol-4-yl)propanoate hydrochloride, 95%, 1-(Phenylmethyl)-L-histidine Methyl Ester Monohydrochloride, (S)-Methyl 2-amino-3-(1-benzyl-1H-imidazol-4-yl)propanoate hydrochloride 95%. Offered by: Combi-blocks, TRC, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 10mg, 50mg.
Methyl (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoate;hydrochloride (CAS 274927-61-6) is a chemical compound with the molecular formula C14H18ClN3O2 and a molecular weight of 295.76 g/mol. IUPAC name: methyl (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoate;hydrochloride. InChIKey: PDWWNBDQGDYHPH-ZOWNYOTGSA-N.
| Molecular formula | C14H18ClN3O2 |
|---|---|
| Molecular weight | 295.76 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(1-benzylimidazol-4-yl)propanoate;hydrochloride |
| InChIKey | PDWWNBDQGDYHPH-ZOWNYOTGSA-N |
| SMILES | COC(=O)[C@H](CC1=CN(C=N1)CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)