Products 2384315-13-1

CAS 2384315-13-1 is the registry number for Benzyl 2-(cyanomethyl)piperazine-1-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride (CAS 2384315-13-1) is a chemical compound with the molecular formula C14H18ClN3O2 and a molecular weight of 295.76 g/mol. IUPAC name: benzyl 2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: ZGVOKAJRQLORSV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18ClN3O2
Molecular weight295.76 g/mol
IUPAC namebenzyl 2-(cyanomethyl)piperazine-1-carboxylate;hydrochloride
InChIKeyZGVOKAJRQLORSV-UHFFFAOYSA-N
SMILESC1CN(C(CN1)CC#N)C(=O)OCC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)