Products 2749328-26-3
CAS 2749328-26-3 is the registry number for JWH 203 N–pentanoic acid metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
5-[3-[2-(2-chlorophenyl)acetyl]-2,4,5,6,7-pentadeuterioindol-1-yl]pentanoic acid (CAS 2749328-26-3) is a chemical compound with the molecular formula C21H20ClNO3 and a molecular weight of 374.9 g/mol. IUPAC name: 5-[3-[2-(2-chlorophenyl)acetyl]-2,4,5,6,7-pentadeuterioindol-1-yl]pentanoic acid. InChIKey: VFGXRQTXBKIHBH-JKOMNXMKSA-N.
| Molecular formula | C21H20ClNO3 |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | 5-[3-[2-(2-chlorophenyl)acetyl]-2,4,5,6,7-pentadeuterioindol-1-yl]pentanoic acid |
| InChIKey | VFGXRQTXBKIHBH-JKOMNXMKSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(=O)O)[2H])C(=O)CC3=CC=CC=C3Cl)[2H])[2H] |
Computed by PubChem (NCBI)