CAS 865415-09-4 appears in our catalog under these names: 2-(3-Butoxyphenyl)-7-chloro-8-methylquinoline-4-carboxylic acid, 95%, 2-(3-Butoxyphenyl)-7-chloro-8-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3-butoxyphenyl)-7-chloro-8-methylquinoline-4-carboxylic acid (CAS 865415-09-4) is a chemical compound with the molecular formula C21H20ClNO3 and a molecular weight of 369.8 g/mol. IUPAC name: 2-(3-butoxyphenyl)-7-chloro-8-methylquinoline-4-carboxylic acid. InChIKey: RAHHPWFPFLEJSX-UHFFFAOYSA-N.
| Molecular formula | C21H20ClNO3 |
|---|---|
| Molecular weight | 369.8 g/mol |
| IUPAC name | 2-(3-butoxyphenyl)-7-chloro-8-methylquinoline-4-carboxylic acid |
| InChIKey | RAHHPWFPFLEJSX-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=CC(=C1)C2=NC3=C(C=CC(=C3C)Cl)C(=C2)C(=O)O |
Computed by PubChem (NCBI)