CAS 2749600-78-8 is the registry number for Ethyl 5-(2-cyclopropoxy-5-(trifluoromethyl)phenyl)oxazole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-[2-cyclopropyloxy-5-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxylate (CAS 2749600-78-8) is a chemical compound with the molecular formula C16H14F3NO4 and a molecular weight of 341.28 g/mol. IUPAC name: ethyl 5-[2-cyclopropyloxy-5-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxylate. InChIKey: RQPSVMZYCABIBW-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO4 |
|---|---|
| Molecular weight | 341.28 g/mol |
| IUPAC name | ethyl 5-[2-cyclopropyloxy-5-(trifluoromethyl)phenyl]-1,3-oxazole-2-carboxylate |
| InChIKey | RQPSVMZYCABIBW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(O1)C2=C(C=CC(=C2)C(F)(F)F)OC3CC3 |
Computed by PubChem (NCBI)