CAS 69335-90-6 appears in our catalog under these names: Fluazifop-methyl, Fluazifop methyl ester, Fluazifop-methyl, Concentration: 10.0 µg/ml Solvent: Acetonitrile, Fluazifop-methyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 10mg, 50mg, 5mg, 1x50mg, 1x10ml, 1x5ml.
Methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate (CAS 69335-90-6) is a chemical compound with the molecular formula C16H14F3NO4 and a molecular weight of 341.28 g/mol. IUPAC name: methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate. InChIKey: IAUMNRCGDHLAMJ-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO4 |
|---|---|
| Molecular weight | 341.28 g/mol |
| IUPAC name | methyl 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoate |
| InChIKey | IAUMNRCGDHLAMJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)OC1=CC=C(C=C1)OC2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)