Products 2749691-62-9
CAS 2749691-62-9 is the registry number for 3-(Methylthio)-5-(trifluoromethoxy)benzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-methylsulfanyl-5-(trifluoromethoxy)benzoic acid (CAS 2749691-62-9) is a chemical compound with the molecular formula C9H7F3O3S and a molecular weight of 252.21 g/mol. IUPAC name: 3-methylsulfanyl-5-(trifluoromethoxy)benzoic acid. InChIKey: VMDIVPOTLNFKMB-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3S |
|---|---|
| Molecular weight | 252.21 g/mol |
| IUPAC name | 3-methylsulfanyl-5-(trifluoromethoxy)benzoic acid |
| InChIKey | VMDIVPOTLNFKMB-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)