Products 898787-39-8

CAS 898787-39-8 is the registry number for 5-(2,2,2-Trifluoroacetyl)-2-thiophenecarboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 1g, 250mg, 2g.

Structural formula: {0} (CAS {1})

Ethyl 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxylate (CAS 898787-39-8) is a chemical compound with the molecular formula C9H7F3O3S and a molecular weight of 252.21 g/mol. IUPAC name: ethyl 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxylate. InChIKey: OCKQIBUJPOSIOM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O3S
Molecular weight252.21 g/mol
IUPAC nameethyl 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxylate
InChIKeyOCKQIBUJPOSIOM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(S1)C(=O)C(F)(F)F

Computed by PubChem (NCBI)