CAS 898787-39-8 is the registry number for 5-(2,2,2-Trifluoroacetyl)-2-thiophenecarboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 1g, 250mg, 2g.
Ethyl 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxylate (CAS 898787-39-8) is a chemical compound with the molecular formula C9H7F3O3S and a molecular weight of 252.21 g/mol. IUPAC name: ethyl 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxylate. InChIKey: OCKQIBUJPOSIOM-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3S |
|---|---|
| Molecular weight | 252.21 g/mol |
| IUPAC name | ethyl 5-(2,2,2-trifluoroacetyl)thiophene-2-carboxylate |
| InChIKey | OCKQIBUJPOSIOM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(S1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)