Products 2749799-73-1
CAS 2749799-73-1 appears in our catalog under these names: Disulfiram impurity 1-d10, Methyl (Diethyl-d10)dithiocarbamate. Offered by: MedChemExpress, TRC. Available pack sizes: 1mg, 5mg, 50mg.
Methyl N,N-bis(1,1,2,2,2-pentadeuterioethyl)carbamodithioate (CAS 2749799-73-1) is a chemical compound with the molecular formula C6H13NS2 and a molecular weight of 173.4 g/mol. IUPAC name: methyl N,N-bis(1,1,2,2,2-pentadeuterioethyl)carbamodithioate. InChIKey: JYRXPFCUABYLPD-IZUSZFKNSA-N.
| Molecular formula | C6H13NS2 |
|---|---|
| Molecular weight | 173.4 g/mol |
| IUPAC name | methyl N,N-bis(1,1,2,2,2-pentadeuterioethyl)carbamodithioate |
| InChIKey | JYRXPFCUABYLPD-IZUSZFKNSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C(=S)SC)C([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)