CAS 638-17-5 appears in our catalog under these names: Thialdine, 5,6–dihydro–2,4,6–trimethyl–1,3,5–dithiazine, Dihydro-2,4,6-trimethyl-1,3,5(4H)dithiazine, 98%(GC),RG, 98%(GC),RG. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 25g, 5g, 250mg, 1g, 100g.
(4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane (CAS 638-17-5) is a chemical compound with the molecular formula C6H13NS2 and a molecular weight of 163.3 g/mol. IUPAC name: (4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane. InChIKey: FBMVFHKKLDGLJA-XEAPYIEGSA-N.
| Molecular formula | C6H13NS2 |
|---|---|
| Molecular weight | 163.3 g/mol |
| IUPAC name | (4R,6S)-2,4,6-trimethyl-1,3,5-dithiazinane |
| InChIKey | FBMVFHKKLDGLJA-XEAPYIEGSA-N |
| SMILES | C[C@@H]1N[C@@H](SC(S1)C)C |
Computed by PubChem (NCBI)