Products 2749910-55-0
CAS 2749910-55-0 appears in our catalog under these names: Nicotinamide–13C6, Nicotinamide-13C6, 99.8%, Nicotinamide-13C6. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg.
(2,3,4,5,6-13C5)pyridine-3-carboxamide (CAS 2749910-55-0) is a chemical compound with the molecular formula C6H6N2O and a molecular weight of 128.081 g/mol. IUPAC name: (2,3,4,5,6-13C5)pyridine-3-carboxamide. InChIKey: DFPAKSUCGFBDDF-IDEBNGHGSA-N.
| Molecular formula | C6H6N2O |
|---|---|
| Molecular weight | 128.081 g/mol |
| IUPAC name | (2,3,4,5,6-13C5)pyridine-3-carboxamide |
| InChIKey | DFPAKSUCGFBDDF-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH]N=[13CH]1)[13C](=O)N |
Computed by PubChem (NCBI)