CAS 2750499-68-2 is the registry number for (R)-(4-Benzyl-6-fluoro-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R)-4-benzyl-6-fluoro-2,3-dihydro-1,4-benzoxazin-2-yl]methanol (CAS 2750499-68-2) is a chemical compound with the molecular formula C16H16FNO2 and a molecular weight of 273.30 g/mol. IUPAC name: [(2R)-4-benzyl-6-fluoro-2,3-dihydro-1,4-benzoxazin-2-yl]methanol. InChIKey: XQFMTUDNFUTTOS-CQSZACIVSA-N.
| Molecular formula | C16H16FNO2 |
|---|---|
| Molecular weight | 273.30 g/mol |
| IUPAC name | [(2R)-4-benzyl-6-fluoro-2,3-dihydro-1,4-benzoxazin-2-yl]methanol |
| InChIKey | XQFMTUDNFUTTOS-CQSZACIVSA-N |
| SMILES | C1[C@@H](OC2=C(N1CC3=CC=CC=C3)C=C(C=C2)F)CO |
Computed by PubChem (NCBI)