CAS 914644-63-6 is the registry number for (S)-3-Amino-2-((4'-fluoro-[1,1'-biphenyl]-2-yl)methyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(aminomethyl)-3-[2-(4-fluorophenyl)phenyl]propanoic acid (CAS 914644-63-6) is a chemical compound with the molecular formula C16H16FNO2 and a molecular weight of 273.30 g/mol. IUPAC name: (2S)-2-(aminomethyl)-3-[2-(4-fluorophenyl)phenyl]propanoic acid. InChIKey: RJXGEMXSPNQVCP-ZDUSSCGKSA-N.
| Molecular formula | C16H16FNO2 |
|---|---|
| Molecular weight | 273.30 g/mol |
| IUPAC name | (2S)-2-(aminomethyl)-3-[2-(4-fluorophenyl)phenyl]propanoic acid |
| InChIKey | RJXGEMXSPNQVCP-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](CN)C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)